About 3-[bis(prop-2-enyl)amino]propanoic acid;piperidine-1-carboxamide
3-[bis(prop-2-enyl)amino]propanoic acid;piperidine-1-carboxamide (PubChem CID 68545523) has the molecular formula C15H27N3O3
and a molecular weight of 297.40 g/mol. Its IUPAC name is 3-[bis(prop-2-enyl)amino]propanoic acid;piperidine-1-carboxamide.
Molecular Properties
| Compound Name | 3-[bis(prop-2-enyl)amino]propanoic acid;piperidine-1-carboxamide |
| PubChem CID | 68545523 |
| Molecular Formula | C15H27N3O3 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 3-[bis(prop-2-enyl)amino]propanoic acid;piperidine-1-carboxamide |
| SMILES | C=CCN(CC=C)CCC(=O)O.NC(=O)N1CCCCC1 |
| InChI | InChI=1S/C9H15NO2.C6H12N2O/c1-3-6-10(7-4-2)8-5-9(11)12;7-6(9)8-4-2-1-3-5-8/h3-4H,1-2,5-8H2,(H,11,12);1-5H2,(H2,7,9) |
| InChIKey | NIEWPFOQBPBIFG-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[bis(prop-2-enyl)amino]propanoic acid;piperidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[bis(prop-2-enyl)amino]propanoic acid;piperidine-1-carboxamide?
The IUPAC name of 3-[bis(prop-2-enyl)amino]propanoic acid;piperidine-1-carboxamide (CID 68545523) is 3-[bis(prop-2-enyl)amino]propanoic acid;piperidine-1-carboxamide.
What is the SMILES notation for 3-[bis(prop-2-enyl)amino]propanoic acid;piperidine-1-carboxamide?
The canonical SMILES for 3-[bis(prop-2-enyl)amino]propanoic acid;piperidine-1-carboxamide is C=CCN(CC=C)CCC(=O)O.NC(=O)N1CCCCC1.
What is the InChIKey of 3-[bis(prop-2-enyl)amino]propanoic acid;piperidine-1-carboxamide?
The InChIKey is NIEWPFOQBPBIFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO2.C6H12N2O/c1-3-6-10(7-4-2)8-5-9(11)12;7-6(9)8-4-2-1-3-5-8/h3-4H,1-2,5-8H2,(H,11,12);1-5H2,(H2,7,9).
What are the key properties of 3-[bis(prop-2-enyl)amino]propanoic acid;piperidine-1-carboxamide?
3-[bis(prop-2-enyl)amino]propanoic acid;piperidine-1-carboxamide has a molecular weight of 297.40 g/mol, XLogP of 1.69, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[bis(prop-2-enyl)amino]propanoic acid;piperidine-1-carboxamide is sourced from PubChem (CID 68545523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).