C18H16F3NO2 — CID 68545814
4-[4-(trifluoromethyl)phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodecane-3,5-dione (PubChem CID 68545814) has the molecular formula C18H16F3NO2 and a molecular weight of 335.33 g/mol. Its IUPAC name is 4-[4-(trifluoromethyl)phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodecane-3,5-dione.
| Compound Name | 4-[4-(trifluoromethyl)phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodecane-3,5-dione |
|---|---|
| PubChem CID | 68545814 |
| Molecular Formula | C18H16F3NO2 |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 4-[4-(trifluoromethyl)phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodecane-3,5-dione |
| SMILES | O=C1C2C3CCC(C4CC43)C2C(=O)N1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H16F3NO2/c19-18(20,21)8-1-3-9(4-2-8)22-16(23)14-10-5-6-11(13-7-12(10)13)15(14)17(22)24/h1-4,10-15H,5-7H2 |
| InChIKey | XHZYEDBTKZOCBG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|