C18H18N2O4S — CID 68545829
4-[(3aR,4S,7R,7aS)-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-methylsulfinylbenzonitrile (PubChem CID 68545829) has the molecular formula C18H18N2O4S and a molecular weight of 358.42 g/mol. Its IUPAC name is 4-[(3aR,4S,7R,7aS)-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-methylsulfinylbenzonitrile.
| Compound Name | 4-[(3aR,4S,7R,7aS)-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-methylsulfinylbenzonitrile |
|---|---|
| PubChem CID | 68545829 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 4-[(3aR,4S,7R,7aS)-4,7-dimethyl-1,3-dioxo-3a,5,6,7a-tetrahydro-4,7-epoxyisoindol-2-yl]-2-methylsulfinylbenzonitrile |
| SMILES | CS(=O)c1cc(N2C(=O)[C@@H]3[C@H](C2=O)[C@@]2(C)CC[C@]3(C)O2)ccc1C#N |
| InChI | InChI=1S/C18H18N2O4S/c1-17-6-7-18(2,24-17)14-13(17)15(21)20(16(14)22)11-5-4-10(9-19)12(8-11)25(3)23/h4-5,8,13-14H,6-7H2,1-3H3/t13-,14+,17-,18+,25? |
| InChIKey | CFWODENMRMWODT-KXULHVPLSA-N |
| XLogP | 1.74 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|