About 7-[2-(3,3-diethoxypropyl)-4-pyridinyl]imidazo[1,2-a]pyridine
7-[2-(3,3-diethoxypropyl)-4-pyridinyl]imidazo[1,2-a]pyridine (PubChem CID 68546003) has the molecular formula C19H23N3O2
and a molecular weight of 325.41 g/mol. Its IUPAC name is 7-[2-(3,3-diethoxypropyl)-4-pyridinyl]imidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 7-[2-(3,3-diethoxypropyl)-4-pyridinyl]imidazo[1,2-a]pyridine |
| PubChem CID | 68546003 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 7-[2-(3,3-diethoxypropyl)-4-pyridinyl]imidazo[1,2-a]pyridine |
| SMILES | CCOC(CCc1cc(-c2ccn3ccnc3c2)ccn1)OCC |
| InChI | InChI=1S/C19H23N3O2/c1-3-23-19(24-4-2)6-5-17-13-15(7-9-20-17)16-8-11-22-12-10-21-18(22)14-16/h7-14,19H,3-6H2,1-2H3 |
| InChIKey | VDWBVIBDTMIQJB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 48.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 7-[2-(3,3-diethoxypropyl)-4-pyridinyl]imidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[2-(3,3-diethoxypropyl)-4-pyridinyl]imidazo[1,2-a]pyridine?
The IUPAC name of 7-[2-(3,3-diethoxypropyl)-4-pyridinyl]imidazo[1,2-a]pyridine (CID 68546003) is 7-[2-(3,3-diethoxypropyl)-4-pyridinyl]imidazo[1,2-a]pyridine.
What is the SMILES notation for 7-[2-(3,3-diethoxypropyl)-4-pyridinyl]imidazo[1,2-a]pyridine?
The canonical SMILES for 7-[2-(3,3-diethoxypropyl)-4-pyridinyl]imidazo[1,2-a]pyridine is CCOC(CCc1cc(-c2ccn3ccnc3c2)ccn1)OCC.
What is the InChIKey of 7-[2-(3,3-diethoxypropyl)-4-pyridinyl]imidazo[1,2-a]pyridine?
The InChIKey is VDWBVIBDTMIQJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N3O2/c1-3-23-19(24-4-2)6-5-17-13-15(7-9-20-17)16-8-11-22-12-10-21-18(22)14-16/h7-14,19H,3-6H2,1-2H3.
What are the key properties of 7-[2-(3,3-diethoxypropyl)-4-pyridinyl]imidazo[1,2-a]pyridine?
7-[2-(3,3-diethoxypropyl)-4-pyridinyl]imidazo[1,2-a]pyridine has a molecular weight of 325.41 g/mol, XLogP of 3.73, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[2-(3,3-diethoxypropyl)-4-pyridinyl]imidazo[1,2-a]pyridine is sourced from PubChem (CID 68546003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).