C18H17FN5O+ — CID 68546048
1-[2-[4-amino-2-(3-fluorophenyl)-[1,2,4]triazolo[1,5-a]pyrazin-4-ium-6-yl]ethynyl]cyclopentan-1-ol (PubChem CID 68546048) has the molecular formula C18H17FN5O+ and a molecular weight of 338.37 g/mol. Its IUPAC name is 1-[2-[4-amino-2-(3-fluorophenyl)-[1,2,4]triazolo[1,5-a]pyrazin-4-ium-6-yl]ethynyl]cyclopentan-1-ol.
| Compound Name | 1-[2-[4-amino-2-(3-fluorophenyl)-[1,2,4]triazolo[1,5-a]pyrazin-4-ium-6-yl]ethynyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 68546048 |
| Molecular Formula | C18H17FN5O+ |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 1-[2-[4-amino-2-(3-fluorophenyl)-[1,2,4]triazolo[1,5-a]pyrazin-4-ium-6-yl]ethynyl]cyclopentan-1-ol |
| SMILES | N[N+]12C=C(C#CC3(O)CCCC3)N=CC1=NC(c1cccc(F)c1)=N2 |
| InChI | InChI=1S/C18H17FN5O/c19-14-5-3-4-13(10-14)17-22-16-11-21-15(12-24(16,20)23-17)6-9-18(25)7-1-2-8-18/h3-5,10-12,25H,1-2,7-8,20H2/q+1 |
| InChIKey | FRBSNWDZRATAOE-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 83.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|