About 3,5-bis(furan-2-yl)-2,6-bis(furan-2-ylmethylidene)-4-methyl-4-nitrocyclohexan-1-one
3,5-bis(furan-2-yl)-2,6-bis(furan-2-ylmethylidene)-4-methyl-4-nitrocyclohexan-1-one (PubChem CID 68546064) has the molecular formula C25H19NO7
and a molecular weight of 445.43 g/mol. Its IUPAC name is 3,5-bis(furan-2-yl)-2,6-bis(furan-2-ylmethylidene)-4-methyl-4-nitrocyclohexan-1-one.
Molecular Properties
| Compound Name | 3,5-bis(furan-2-yl)-2,6-bis(furan-2-ylmethylidene)-4-methyl-4-nitrocyclohexan-1-one |
| PubChem CID | 68546064 |
| Molecular Formula | C25H19NO7 |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | 3,5-bis(furan-2-yl)-2,6-bis(furan-2-ylmethylidene)-4-methyl-4-nitrocyclohexan-1-one |
| SMILES | CC1([N+](=O)[O-])C(c2ccco2)C(=Cc2ccco2)C(=O)C(=Cc2ccco2)C1c1ccco1 |
| InChI | InChI=1S/C25H19NO7/c1-25(26(28)29)22(20-8-4-12-32-20)18(14-16-6-2-10-30-16)24(27)19(15-17-7-3-11-31-17)23(25)21-9-5-13-33-21/h2-15,22-23H,1H3 |
| InChIKey | BUKUONUQBUXVPA-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 112.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,5-bis(furan-2-yl)-2,6-bis(furan-2-ylmethylidene)-4-methyl-4-nitrocyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-bis(furan-2-yl)-2,6-bis(furan-2-ylmethylidene)-4-methyl-4-nitrocyclohexan-1-one?
The IUPAC name of 3,5-bis(furan-2-yl)-2,6-bis(furan-2-ylmethylidene)-4-methyl-4-nitrocyclohexan-1-one (CID 68546064) is 3,5-bis(furan-2-yl)-2,6-bis(furan-2-ylmethylidene)-4-methyl-4-nitrocyclohexan-1-one.
What is the SMILES notation for 3,5-bis(furan-2-yl)-2,6-bis(furan-2-ylmethylidene)-4-methyl-4-nitrocyclohexan-1-one?
The canonical SMILES for 3,5-bis(furan-2-yl)-2,6-bis(furan-2-ylmethylidene)-4-methyl-4-nitrocyclohexan-1-one is CC1([N+](=O)[O-])C(c2ccco2)C(=Cc2ccco2)C(=O)C(=Cc2ccco2)C1c1ccco1.
What is the InChIKey of 3,5-bis(furan-2-yl)-2,6-bis(furan-2-ylmethylidene)-4-methyl-4-nitrocyclohexan-1-one?
The InChIKey is BUKUONUQBUXVPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H19NO7/c1-25(26(28)29)22(20-8-4-12-32-20)18(14-16-6-2-10-30-16)24(27)19(15-17-7-3-11-31-17)23(25)21-9-5-13-33-21/h2-15,22-23H,1H3.
What are the key properties of 3,5-bis(furan-2-yl)-2,6-bis(furan-2-ylmethylidene)-4-methyl-4-nitrocyclohexan-1-one?
3,5-bis(furan-2-yl)-2,6-bis(furan-2-ylmethylidene)-4-methyl-4-nitrocyclohexan-1-one has a molecular weight of 445.43 g/mol, XLogP of 5.71, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis(furan-2-yl)-2,6-bis(furan-2-ylmethylidene)-4-methyl-4-nitrocyclohexan-1-one is sourced from PubChem (CID 68546064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).