C18H16F3NO2S — CID 68546366
4-[4-(trifluoromethylsulfanyl)phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodecane-3,5-dione (PubChem CID 68546366) has the molecular formula C18H16F3NO2S and a molecular weight of 367.39 g/mol. Its IUPAC name is 4-[4-(trifluoromethylsulfanyl)phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodecane-3,5-dione.
| Compound Name | 4-[4-(trifluoromethylsulfanyl)phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodecane-3,5-dione |
|---|---|
| PubChem CID | 68546366 |
| Molecular Formula | C18H16F3NO2S |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 4-[4-(trifluoromethylsulfanyl)phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodecane-3,5-dione |
| SMILES | O=C1C2C3CCC(C4CC43)C2C(=O)N1c1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H16F3NO2S/c19-18(20,21)25-9-3-1-8(2-4-9)22-16(23)14-10-5-6-11(13-7-12(10)13)15(14)17(22)24/h1-4,10-15H,5-7H2 |
| InChIKey | DZVKGHHSOOHMGK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|