C17H18BrN3O2 — CID 68546471
7-bromo-3-[(2,6-dimethoxyphenyl)methyl]-4H-quinazolin-2-amine (PubChem CID 68546471) has the molecular formula C17H18BrN3O2 and a molecular weight of 376.25 g/mol. Its IUPAC name is 7-bromo-3-[(2,6-dimethoxyphenyl)methyl]-4H-quinazolin-2-amine.
| Compound Name | 7-bromo-3-[(2,6-dimethoxyphenyl)methyl]-4H-quinazolin-2-amine |
|---|---|
| PubChem CID | 68546471 |
| Molecular Formula | C17H18BrN3O2 |
| Molecular Weight | 376.25 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 7-bromo-3-[(2,6-dimethoxyphenyl)methyl]-4H-quinazolin-2-amine |
| SMILES | COc1cccc(OC)c1CN1Cc2ccc(Br)cc2N=C1N |
| InChI | InChI=1S/C17H18BrN3O2/c1-22-15-4-3-5-16(23-2)13(15)10-21-9-11-6-7-12(18)8-14(11)20-17(21)19/h3-8H,9-10H2,1-2H3,(H2,19,20) |
| InChIKey | HCEGZCOEHSMPCN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.25 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |