About 1-N-methylpyrrolidine-1,2-diamine
1-N-methylpyrrolidine-1,2-diamine (PubChem CID 68546564) has the molecular formula C5H13N3
and a molecular weight of 115.18 g/mol. Its IUPAC name is 1-N-methylpyrrolidine-1,2-diamine.
Molecular Properties
| Compound Name | 1-N-methylpyrrolidine-1,2-diamine |
| PubChem CID | 68546564 |
| Molecular Formula | C5H13N3 |
| Molecular Weight | 115.18 g/mol |
| Exact Mass | 115.11 |
| IUPAC Name | 1-N-methylpyrrolidine-1,2-diamine |
| SMILES | CNN1CCCC1N |
| InChI | InChI=1S/C5H13N3/c1-7-8-4-2-3-5(8)6/h5,7H,2-4,6H2,1H3 |
| InChIKey | IWDXLQTYQMRCNP-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.18 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-N-methylpyrrolidine-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-methylpyrrolidine-1,2-diamine?
The IUPAC name of 1-N-methylpyrrolidine-1,2-diamine (CID 68546564) is 1-N-methylpyrrolidine-1,2-diamine.
What is the SMILES notation for 1-N-methylpyrrolidine-1,2-diamine?
The canonical SMILES for 1-N-methylpyrrolidine-1,2-diamine is CNN1CCCC1N.
What is the InChIKey of 1-N-methylpyrrolidine-1,2-diamine?
The InChIKey is IWDXLQTYQMRCNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N3/c1-7-8-4-2-3-5(8)6/h5,7H,2-4,6H2,1H3.
What are the key properties of 1-N-methylpyrrolidine-1,2-diamine?
1-N-methylpyrrolidine-1,2-diamine has a molecular weight of 115.18 g/mol, XLogP of -0.50, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-methylpyrrolidine-1,2-diamine is sourced from PubChem (CID 68546564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).