About 6-O-tert-butyl 2-O-methyl 3-(2-ethoxy-2-oxoethoxy)thieno[3,2-b][1]benzothiole-2,6-dicarboxylate
6-O-tert-butyl 2-O-methyl 3-(2-ethoxy-2-oxoethoxy)thieno[3,2-b][1]benzothiole-2,6-dicarboxylate (PubChem CID 68546606) has the molecular formula C21H22O7S2
and a molecular weight of 450.53 g/mol. Its IUPAC name is 6-O-tert-butyl 2-O-methyl 3-(2-ethoxy-2-oxoethoxy)thieno[3,2-b][1]benzothiole-2,6-dicarboxylate.
Molecular Properties
| Compound Name | 6-O-tert-butyl 2-O-methyl 3-(2-ethoxy-2-oxoethoxy)thieno[3,2-b][1]benzothiole-2,6-dicarboxylate |
| PubChem CID | 68546606 |
| Molecular Formula | C21H22O7S2 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | 6-O-tert-butyl 2-O-methyl 3-(2-ethoxy-2-oxoethoxy)thieno[3,2-b][1]benzothiole-2,6-dicarboxylate |
| SMILES | CCOC(=O)COc1c(C(=O)OC)sc2c1sc1cc(C(=O)OC(C)(C)C)ccc12 |
| InChI | InChI=1S/C21H22O7S2/c1-6-26-14(22)10-27-15-17-16(30-18(15)20(24)25-5)12-8-7-11(9-13(12)29-17)19(23)28-21(2,3)4/h7-9H,6,10H2,1-5H3 |
| InChIKey | RVPXYZKSPZBFEP-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze 6-O-tert-butyl 2-O-methyl 3-(2-ethoxy-2-oxoethoxy)thieno[3,2-b][1]benzothiole-2,6-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-O-tert-butyl 2-O-methyl 3-(2-ethoxy-2-oxoethoxy)thieno[3,2-b][1]benzothiole-2,6-dicarboxylate?
The IUPAC name of 6-O-tert-butyl 2-O-methyl 3-(2-ethoxy-2-oxoethoxy)thieno[3,2-b][1]benzothiole-2,6-dicarboxylate (CID 68546606) is 6-O-tert-butyl 2-O-methyl 3-(2-ethoxy-2-oxoethoxy)thieno[3,2-b][1]benzothiole-2,6-dicarboxylate.
What is the SMILES notation for 6-O-tert-butyl 2-O-methyl 3-(2-ethoxy-2-oxoethoxy)thieno[3,2-b][1]benzothiole-2,6-dicarboxylate?
The canonical SMILES for 6-O-tert-butyl 2-O-methyl 3-(2-ethoxy-2-oxoethoxy)thieno[3,2-b][1]benzothiole-2,6-dicarboxylate is CCOC(=O)COc1c(C(=O)OC)sc2c1sc1cc(C(=O)OC(C)(C)C)ccc12.
What is the InChIKey of 6-O-tert-butyl 2-O-methyl 3-(2-ethoxy-2-oxoethoxy)thieno[3,2-b][1]benzothiole-2,6-dicarboxylate?
The InChIKey is RVPXYZKSPZBFEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22O7S2/c1-6-26-14(22)10-27-15-17-16(30-18(15)20(24)25-5)12-8-7-11(9-13(12)29-17)19(23)28-21(2,3)4/h7-9H,6,10H2,1-5H3.
What are the key properties of 6-O-tert-butyl 2-O-methyl 3-(2-ethoxy-2-oxoethoxy)thieno[3,2-b][1]benzothiole-2,6-dicarboxylate?
6-O-tert-butyl 2-O-methyl 3-(2-ethoxy-2-oxoethoxy)thieno[3,2-b][1]benzothiole-2,6-dicarboxylate has a molecular weight of 450.53 g/mol, XLogP of 4.80, 6 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 6-O-tert-butyl 2-O-methyl 3-(2-ethoxy-2-oxoethoxy)thieno[3,2-b][1]benzothiole-2,6-dicarboxylate is sourced from PubChem (CID 68546606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).