C18H19NO7S2 — CID 68546683
[(3S,4S,5R,6R)-4,5-diacetyloxy-6-(1,3-benzothiazol-6-yloxy)thian-3-yl] acetate (PubChem CID 68546683) has the molecular formula C18H19NO7S2 and a molecular weight of 425.48 g/mol. Its IUPAC name is [(3S,4S,5R,6R)-4,5-diacetyloxy-6-(1,3-benzothiazol-6-yloxy)thian-3-yl] acetate.
| Compound Name | [(3S,4S,5R,6R)-4,5-diacetyloxy-6-(1,3-benzothiazol-6-yloxy)thian-3-yl] acetate |
|---|---|
| PubChem CID | 68546683 |
| Molecular Formula | C18H19NO7S2 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | [(3S,4S,5R,6R)-4,5-diacetyloxy-6-(1,3-benzothiazol-6-yloxy)thian-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)CS[C@H]1Oc1ccc2ncsc2c1 |
| InChI | InChI=1S/C18H19NO7S2/c1-9(20)23-14-7-27-18(17(25-11(3)22)16(14)24-10(2)21)26-12-4-5-13-15(6-12)28-8-19-13/h4-6,8,14,16-18H,7H2,1-3H3/t14-,16+,17-,18-/m1/s1 |
| InChIKey | WHGNRYVMUAXJKO-BZZMCLGOSA-N |
| XLogP | 2.54 |
| TPSA | 101.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|