C17H14N2O5 — CID 68546783
4-(4-methyl-3-nitrophenyl)-4-azatricyclo[5.2.2.02,6]undec-1-ene-3,5,8-trione (PubChem CID 68546783) has the molecular formula C17H14N2O5 and a molecular weight of 326.31 g/mol. Its IUPAC name is 4-(4-methyl-3-nitrophenyl)-4-azatricyclo[5.2.2.02,6]undec-1-ene-3,5,8-trione.
| Compound Name | 4-(4-methyl-3-nitrophenyl)-4-azatricyclo[5.2.2.02,6]undec-1-ene-3,5,8-trione |
|---|---|
| PubChem CID | 68546783 |
| Molecular Formula | C17H14N2O5 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 4-(4-methyl-3-nitrophenyl)-4-azatricyclo[5.2.2.02,6]undec-1-ene-3,5,8-trione |
| SMILES | Cc1ccc(N2C(=O)C3=C4CCC(C(=O)C4)C3C2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H14N2O5/c1-8-2-4-10(7-12(8)19(23)24)18-16(21)14-9-3-5-11(13(20)6-9)15(14)17(18)22/h2,4,7,11,15H,3,5-6H2,1H3 |
| InChIKey | XQCVQGBMXRLWJE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|