About [4-[6,7-difluoro-3-(4-methoxyphenyl)-2-oxo-1H-indol-3-yl]phenyl] 3-(2-aminophenyl)propanoate
[4-[6,7-difluoro-3-(4-methoxyphenyl)-2-oxo-1H-indol-3-yl]phenyl] 3-(2-aminophenyl)propanoate (PubChem CID 68546824) has the molecular formula C30H24F2N2O4
and a molecular weight of 514.53 g/mol. Its IUPAC name is [4-[6,7-difluoro-3-(4-methoxyphenyl)-2-oxo-1H-indol-3-yl]phenyl] 3-(2-aminophenyl)propanoate.
Molecular Properties
| Compound Name | [4-[6,7-difluoro-3-(4-methoxyphenyl)-2-oxo-1H-indol-3-yl]phenyl] 3-(2-aminophenyl)propanoate |
| PubChem CID | 68546824 |
| Molecular Formula | C30H24F2N2O4 |
| Molecular Weight | 514.53 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | [4-[6,7-difluoro-3-(4-methoxyphenyl)-2-oxo-1H-indol-3-yl]phenyl] 3-(2-aminophenyl)propanoate |
| SMILES | COc1ccc(C2(c3ccc(OC(=O)CCc4ccccc4N)cc3)C(=O)Nc3c2ccc(F)c3F)cc1 |
| InChI | InChI=1S/C30H24F2N2O4/c1-37-21-11-7-19(8-12-21)30(23-15-16-24(31)27(32)28(23)34-29(30)36)20-9-13-22(14-10-20)38-26(35)17-6-18-4-2-3-5-25(18)33/h2-5,7-16H,6,17,33H2,1H3,(H,34,36) |
| InChIKey | KQWSXAPHRMMMTQ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 514.53 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[6,7-difluoro-3-(4-methoxyphenyl)-2-oxo-1H-indol-3-yl]phenyl] 3-(2-aminophenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[6,7-difluoro-3-(4-methoxyphenyl)-2-oxo-1H-indol-3-yl]phenyl] 3-(2-aminophenyl)propanoate?
The IUPAC name of [4-[6,7-difluoro-3-(4-methoxyphenyl)-2-oxo-1H-indol-3-yl]phenyl] 3-(2-aminophenyl)propanoate (CID 68546824) is [4-[6,7-difluoro-3-(4-methoxyphenyl)-2-oxo-1H-indol-3-yl]phenyl] 3-(2-aminophenyl)propanoate.
What is the SMILES notation for [4-[6,7-difluoro-3-(4-methoxyphenyl)-2-oxo-1H-indol-3-yl]phenyl] 3-(2-aminophenyl)propanoate?
The canonical SMILES for [4-[6,7-difluoro-3-(4-methoxyphenyl)-2-oxo-1H-indol-3-yl]phenyl] 3-(2-aminophenyl)propanoate is COc1ccc(C2(c3ccc(OC(=O)CCc4ccccc4N)cc3)C(=O)Nc3c2ccc(F)c3F)cc1.
What is the InChIKey of [4-[6,7-difluoro-3-(4-methoxyphenyl)-2-oxo-1H-indol-3-yl]phenyl] 3-(2-aminophenyl)propanoate?
The InChIKey is KQWSXAPHRMMMTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H24F2N2O4/c1-37-21-11-7-19(8-12-21)30(23-15-16-24(31)27(32)28(23)34-29(30)36)20-9-13-22(14-10-20)38-26(35)17-6-18-4-2-3-5-25(18)33/h2-5,7-16H,6,17,33H2,1H3,(H,34,36).
What are the key properties of [4-[6,7-difluoro-3-(4-methoxyphenyl)-2-oxo-1H-indol-3-yl]phenyl] 3-(2-aminophenyl)propanoate?
[4-[6,7-difluoro-3-(4-methoxyphenyl)-2-oxo-1H-indol-3-yl]phenyl] 3-(2-aminophenyl)propanoate has a molecular weight of 514.53 g/mol, XLogP of 5.38, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[6,7-difluoro-3-(4-methoxyphenyl)-2-oxo-1H-indol-3-yl]phenyl] 3-(2-aminophenyl)propanoate is sourced from PubChem (CID 68546824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).