About [2,5-bis[(2-methylpropan-2-yl)oxy]phenyl]-methoxy-diphenyl-λ4-sulfane
[2,5-bis[(2-methylpropan-2-yl)oxy]phenyl]-methoxy-diphenyl-λ4-sulfane (PubChem CID 68547676) has the molecular formula C27H34O3S
and a molecular weight of 438.63 g/mol. Its IUPAC name is [2,5-bis[(2-methylpropan-2-yl)oxy]phenyl]-methoxy-diphenyl-λ4-sulfane.
Molecular Properties
| Compound Name | [2,5-bis[(2-methylpropan-2-yl)oxy]phenyl]-methoxy-diphenyl-λ4-sulfane |
| PubChem CID | 68547676 |
| Molecular Formula | C27H34O3S |
| Molecular Weight | 438.63 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | [2,5-bis[(2-methylpropan-2-yl)oxy]phenyl]-methoxy-diphenyl-λ4-sulfane |
| SMILES | COS(c1ccccc1)(c1ccccc1)c1cc(OC(C)(C)C)ccc1OC(C)(C)C |
| InChI | InChI=1S/C27H34O3S/c1-26(2,3)29-21-18-19-24(30-27(4,5)6)25(20-21)31(28-7,22-14-10-8-11-15-22)23-16-12-9-13-17-23/h8-20H,1-7H3 |
| InChIKey | WGRVZEHTVKYSMA-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.63 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2,5-bis[(2-methylpropan-2-yl)oxy]phenyl]-methoxy-diphenyl-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,5-bis[(2-methylpropan-2-yl)oxy]phenyl]-methoxy-diphenyl-λ4-sulfane?
The IUPAC name of [2,5-bis[(2-methylpropan-2-yl)oxy]phenyl]-methoxy-diphenyl-λ4-sulfane (CID 68547676) is [2,5-bis[(2-methylpropan-2-yl)oxy]phenyl]-methoxy-diphenyl-λ4-sulfane.
What is the SMILES notation for [2,5-bis[(2-methylpropan-2-yl)oxy]phenyl]-methoxy-diphenyl-λ4-sulfane?
The canonical SMILES for [2,5-bis[(2-methylpropan-2-yl)oxy]phenyl]-methoxy-diphenyl-λ4-sulfane is COS(c1ccccc1)(c1ccccc1)c1cc(OC(C)(C)C)ccc1OC(C)(C)C.
What is the InChIKey of [2,5-bis[(2-methylpropan-2-yl)oxy]phenyl]-methoxy-diphenyl-λ4-sulfane?
The InChIKey is WGRVZEHTVKYSMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H34O3S/c1-26(2,3)29-21-18-19-24(30-27(4,5)6)25(20-21)31(28-7,22-14-10-8-11-15-22)23-16-12-9-13-17-23/h8-20H,1-7H3.
What are the key properties of [2,5-bis[(2-methylpropan-2-yl)oxy]phenyl]-methoxy-diphenyl-λ4-sulfane?
[2,5-bis[(2-methylpropan-2-yl)oxy]phenyl]-methoxy-diphenyl-λ4-sulfane has a molecular weight of 438.63 g/mol, XLogP of 7.88, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2,5-bis[(2-methylpropan-2-yl)oxy]phenyl]-methoxy-diphenyl-λ4-sulfane is sourced from PubChem (CID 68547676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).