C14H22O8 — CID 68548147
methyl (4R,5S)-5-[(4R,5S)-5-methoxycarbonyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate (PubChem CID 68548147) has the molecular formula C14H22O8 and a molecular weight of 318.32 g/mol. Its IUPAC name is methyl (4R,5S)-5-[(4R,5S)-5-methoxycarbonyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate.
| Compound Name | methyl (4R,5S)-5-[(4R,5S)-5-methoxycarbonyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 68548147 |
| Molecular Formula | C14H22O8 |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | methyl (4R,5S)-5-[(4R,5S)-5-methoxycarbonyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane-4-carboxylate |
| SMILES | COC(=O)[C@H]1OC(C)(C)O[C@@H]1[C@@H]1OC(C)(C)O[C@H]1C(=O)OC |
| InChI | InChI=1S/C14H22O8/c1-13(2)19-7(9(21-13)11(15)17-5)8-10(12(16)18-6)22-14(3,4)20-8/h7-10H,1-6H3/t7-,8+,9+,10- |
| InChIKey | ZTUVBUBNNIOGIC-FIRGSJFUSA-N |
| XLogP | 0.37 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |