C20H27FN2O3S — CID 68548456
N-[(2S,3S)-1-[4-(dimethylamino)phenyl]-1-hydroxy-3-methylpentan-2-yl]-4-fluorobenzenesulfonamide (PubChem CID 68548456) has the molecular formula C20H27FN2O3S and a molecular weight of 394.51 g/mol. Its IUPAC name is N-[(2S,3S)-1-[4-(dimethylamino)phenyl]-1-hydroxy-3-methylpentan-2-yl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[(2S,3S)-1-[4-(dimethylamino)phenyl]-1-hydroxy-3-methylpentan-2-yl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 68548456 |
| Molecular Formula | C20H27FN2O3S |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | N-[(2S,3S)-1-[4-(dimethylamino)phenyl]-1-hydroxy-3-methylpentan-2-yl]-4-fluorobenzenesulfonamide |
| SMILES | CC[C@H](C)[C@H](NS(=O)(=O)c1ccc(F)cc1)C(O)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C20H27FN2O3S/c1-5-14(2)19(20(24)15-6-10-17(11-7-15)23(3)4)22-27(25,26)18-12-8-16(21)9-13-18/h6-14,19-20,22,24H,5H2,1-4H3/t14-,19-,20?/m0/s1 |
| InChIKey | GIKFQWULZBAHSL-VEUFKTSSSA-N |
| XLogP | 3.32 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|