About 3-naphthalen-1-yl-1,2-dihydrobenzimidazole
3-naphthalen-1-yl-1,2-dihydrobenzimidazole (PubChem CID 68549243) has the molecular formula C17H14N2
and a molecular weight of 246.31 g/mol. Its IUPAC name is 3-naphthalen-1-yl-1,2-dihydrobenzimidazole.
Molecular Properties
| Compound Name | 3-naphthalen-1-yl-1,2-dihydrobenzimidazole |
| PubChem CID | 68549243 |
| Molecular Formula | C17H14N2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 3-naphthalen-1-yl-1,2-dihydrobenzimidazole |
| SMILES | c1ccc2c(c1)NCN2c1cccc2ccccc12 |
| InChI | InChI=1S/C17H14N2/c1-2-8-14-13(6-1)7-5-11-16(14)19-12-18-15-9-3-4-10-17(15)19/h1-11,18H,12H2 |
| InChIKey | UENBIXURVHGSFX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-naphthalen-1-yl-1,2-dihydrobenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-naphthalen-1-yl-1,2-dihydrobenzimidazole?
The IUPAC name of 3-naphthalen-1-yl-1,2-dihydrobenzimidazole (CID 68549243) is 3-naphthalen-1-yl-1,2-dihydrobenzimidazole.
What is the SMILES notation for 3-naphthalen-1-yl-1,2-dihydrobenzimidazole?
The canonical SMILES for 3-naphthalen-1-yl-1,2-dihydrobenzimidazole is c1ccc2c(c1)NCN2c1cccc2ccccc12.
What is the InChIKey of 3-naphthalen-1-yl-1,2-dihydrobenzimidazole?
The InChIKey is UENBIXURVHGSFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2/c1-2-8-14-13(6-1)7-5-11-16(14)19-12-18-15-9-3-4-10-17(15)19/h1-11,18H,12H2.
What are the key properties of 3-naphthalen-1-yl-1,2-dihydrobenzimidazole?
3-naphthalen-1-yl-1,2-dihydrobenzimidazole has a molecular weight of 246.31 g/mol, XLogP of 4.36, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-naphthalen-1-yl-1,2-dihydrobenzimidazole is sourced from PubChem (CID 68549243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).