About quinolin-8-yl benzoate
quinolin-8-yl benzoate (PubChem CID 6855) has the molecular formula C16H11NO2
and a molecular weight of 249.27 g/mol. Its IUPAC name is quinolin-8-yl benzoate.
Molecular Properties
| Compound Name | quinolin-8-yl benzoate |
| PubChem CID | 6855 |
| Molecular Formula | C16H11NO2 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | quinolin-8-yl benzoate |
| SMILES | O=C(Oc1cccc2cccnc12)c1ccccc1 |
| InChI | InChI=1S/C16H11NO2/c18-16(13-6-2-1-3-7-13)19-14-10-4-8-12-9-5-11-17-15(12)14/h1-11H |
| InChIKey | BHKPHCKISVSDGV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze quinolin-8-yl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-8-yl benzoate?
The IUPAC name of quinolin-8-yl benzoate (CID 6855) is quinolin-8-yl benzoate.
What is the SMILES notation for quinolin-8-yl benzoate?
The canonical SMILES for quinolin-8-yl benzoate is O=C(Oc1cccc2cccnc12)c1ccccc1.
What is the InChIKey of quinolin-8-yl benzoate?
The InChIKey is BHKPHCKISVSDGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11NO2/c18-16(13-6-2-1-3-7-13)19-14-10-4-8-12-9-5-11-17-15(12)14/h1-11H.
What are the key properties of quinolin-8-yl benzoate?
quinolin-8-yl benzoate has a molecular weight of 249.27 g/mol, XLogP of 3.45, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-8-yl benzoate is sourced from PubChem (CID 6855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).