C10H18N4 — CID 68550195
2-(1H-imidazol-5-yl)-N-(pyrrolidin-2-ylmethyl)ethanamine (PubChem CID 68550195) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is 2-(1H-imidazol-5-yl)-N-(pyrrolidin-2-ylmethyl)ethanamine.
| Compound Name | 2-(1H-imidazol-5-yl)-N-(pyrrolidin-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 68550195 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 2-(1H-imidazol-5-yl)-N-(pyrrolidin-2-ylmethyl)ethanamine |
| SMILES | c1ncc(CCNCC2CCCN2)[nH]1 |
| InChI | InChI=1S/C10H18N4/c1-2-9(13-4-1)6-11-5-3-10-7-12-8-14-10/h7-9,11,13H,1-6H2,(H,12,14) |
| InChIKey | TXUPJNVZAJPFII-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|