About 8-ethylsulfanylquinoline
8-ethylsulfanylquinoline (PubChem CID 685505) has the molecular formula C11H11NS
and a molecular weight of 189.28 g/mol. Its IUPAC name is 8-ethylsulfanylquinoline.
Molecular Properties
| Compound Name | 8-ethylsulfanylquinoline |
| PubChem CID | 685505 |
| Molecular Formula | C11H11NS |
| Molecular Weight | 189.28 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 8-ethylsulfanylquinoline |
| SMILES | CCSc1cccc2cccnc12 |
| InChI | InChI=1S/C11H11NS/c1-2-13-10-7-3-5-9-6-4-8-12-11(9)10/h3-8H,2H2,1H3 |
| InChIKey | WVSRQZPWBKVFCQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.28 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-ethylsulfanylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethylsulfanylquinoline?
The IUPAC name of 8-ethylsulfanylquinoline (CID 685505) is 8-ethylsulfanylquinoline.
What is the SMILES notation for 8-ethylsulfanylquinoline?
The canonical SMILES for 8-ethylsulfanylquinoline is CCSc1cccc2cccnc12.
What is the InChIKey of 8-ethylsulfanylquinoline?
The InChIKey is WVSRQZPWBKVFCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NS/c1-2-13-10-7-3-5-9-6-4-8-12-11(9)10/h3-8H,2H2,1H3.
What are the key properties of 8-ethylsulfanylquinoline?
8-ethylsulfanylquinoline has a molecular weight of 189.28 g/mol, XLogP of 3.35, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethylsulfanylquinoline is sourced from PubChem (CID 685505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).