About 1H-cyclohepta[b]pyrazine
1H-cyclohepta[b]pyrazine (PubChem CID 68550528) has the molecular formula C9H8N2
and a molecular weight of 144.18 g/mol. Its IUPAC name is 1H-cyclohepta[b]pyrazine.
Molecular Properties
| Compound Name | 1H-cyclohepta[b]pyrazine |
| PubChem CID | 68550528 |
| Molecular Formula | C9H8N2 |
| Molecular Weight | 144.18 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | 1H-cyclohepta[b]pyrazine |
| SMILES | C1=CC=C2NC=CN=C2C=C1 |
| InChI | InChI=1S/C9H8N2/c1-2-4-8-9(5-3-1)11-7-6-10-8/h1-7,10H |
| InChIKey | REOZEPNIJZQMLX-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.18 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'colchicine_A(3)', 'substructure': 'N/A'} |
|---|
Analyze 1H-cyclohepta[b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-cyclohepta[b]pyrazine?
The IUPAC name of 1H-cyclohepta[b]pyrazine (CID 68550528) is 1H-cyclohepta[b]pyrazine.
What is the SMILES notation for 1H-cyclohepta[b]pyrazine?
The canonical SMILES for 1H-cyclohepta[b]pyrazine is C1=CC=C2NC=CN=C2C=C1.
What is the InChIKey of 1H-cyclohepta[b]pyrazine?
The InChIKey is REOZEPNIJZQMLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2/c1-2-4-8-9(5-3-1)11-7-6-10-8/h1-7,10H.
What are the key properties of 1H-cyclohepta[b]pyrazine?
1H-cyclohepta[b]pyrazine has a molecular weight of 144.18 g/mol, XLogP of 1.51, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-cyclohepta[b]pyrazine is sourced from PubChem (CID 68550528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).