About (E)-N,2-diphenylethenesulfonamide
(E)-N,2-diphenylethenesulfonamide (PubChem CID 685506) has the molecular formula C14H13NO2S
and a molecular weight of 259.33 g/mol. Its IUPAC name is (E)-N,2-diphenylethenesulfonamide.
Molecular Properties
| Compound Name | (E)-N,2-diphenylethenesulfonamide |
| PubChem CID | 685506 |
| Molecular Formula | C14H13NO2S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | (E)-N,2-diphenylethenesulfonamide |
| SMILES | O=S(=O)(/C=C/c1ccccc1)Nc1ccccc1 |
| InChI | InChI=1S/C14H13NO2S/c16-18(17,15-14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h1-12,15H/b12-11+ |
| InChIKey | HYCDTYSFDAEELD-VAWYXSNFSA-N |
| XLogP | 3.10 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (E)-N,2-diphenylethenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N,2-diphenylethenesulfonamide?
The IUPAC name of (E)-N,2-diphenylethenesulfonamide (CID 685506) is (E)-N,2-diphenylethenesulfonamide.
What is the SMILES notation for (E)-N,2-diphenylethenesulfonamide?
The canonical SMILES for (E)-N,2-diphenylethenesulfonamide is O=S(=O)(/C=C/c1ccccc1)Nc1ccccc1.
What is the InChIKey of (E)-N,2-diphenylethenesulfonamide?
The InChIKey is HYCDTYSFDAEELD-VAWYXSNFSA-N. The full InChI is InChI=1S/C14H13NO2S/c16-18(17,15-14-9-5-2-6-10-14)12-11-13-7-3-1-4-8-13/h1-12,15H/b12-11+.
What are the key properties of (E)-N,2-diphenylethenesulfonamide?
(E)-N,2-diphenylethenesulfonamide has a molecular weight of 259.33 g/mol, XLogP of 3.10, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N,2-diphenylethenesulfonamide is sourced from PubChem (CID 685506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).