C20H28N2O5 — CID 68550824
methyl 2-(5-propan-2-yloxy-2-pyridinyl)acetate;(5-propan-2-yloxy-2-pyridinyl)methanol (PubChem CID 68550824) has the molecular formula C20H28N2O5 and a molecular weight of 376.45 g/mol. Its IUPAC name is methyl 2-(5-propan-2-yloxy-2-pyridinyl)acetate;(5-propan-2-yloxy-2-pyridinyl)methanol.
| Compound Name | methyl 2-(5-propan-2-yloxy-2-pyridinyl)acetate;(5-propan-2-yloxy-2-pyridinyl)methanol |
|---|---|
| PubChem CID | 68550824 |
| Molecular Formula | C20H28N2O5 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | methyl 2-(5-propan-2-yloxy-2-pyridinyl)acetate;(5-propan-2-yloxy-2-pyridinyl)methanol |
| SMILES | CC(C)Oc1ccc(CO)nc1.COC(=O)Cc1ccc(OC(C)C)cn1 |
| InChI | InChI=1S/C11H15NO3.C9H13NO2/c1-8(2)15-10-5-4-9(12-7-10)6-11(13)14-3;1-7(2)12-9-4-3-8(6-11)10-5-9/h4-5,7-8H,6H2,1-3H3;3-5,7,11H,6H2,1-2H3 |
| InChIKey | DKZYEEWIOPMPGK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 90.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |