C23H20O5 — CID 68551126
(1E,6E)-1-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)-7-(4-hydroxyphenyl)hepta-1,6-diene-3,5-dione (PubChem CID 68551126) has the molecular formula C23H20O5 and a molecular weight of 376.41 g/mol. Its IUPAC name is (1E,6E)-1-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)-7-(4-hydroxyphenyl)hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-1-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)-7-(4-hydroxyphenyl)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 68551126 |
| Molecular Formula | C23H20O5 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | (1E,6E)-1-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)-7-(4-hydroxyphenyl)hepta-1,6-diene-3,5-dione |
| SMILES | O=C(/C=C/C1=COC=C(C2=CC=CCC2)O1)CC(=O)/C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C23H20O5/c24-19-9-6-17(7-10-19)8-11-20(25)14-21(26)12-13-22-15-27-16-23(28-22)18-4-2-1-3-5-18/h1-2,4,6-13,15-16,24H,3,5,14H2/b11-8+,13-12+ |
| InChIKey | GHZBDUHJOFGYMY-OWKCIBLPSA-N |
| XLogP | 4.50 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|