C24H24F3N3O4 — CID 68551406
N-[(1R,3S)-3-(1H-benzimidazol-2-yl)cyclohexyl]-2,3-dihydro-1-benzofuran-5-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 68551406) has the molecular formula C24H24F3N3O4 and a molecular weight of 475.47 g/mol. Its IUPAC name is N-[(1R,3S)-3-(1H-benzimidazol-2-yl)cyclohexyl]-2,3-dihydro-1-benzofuran-5-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[(1R,3S)-3-(1H-benzimidazol-2-yl)cyclohexyl]-2,3-dihydro-1-benzofuran-5-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 68551406 |
| Molecular Formula | C24H24F3N3O4 |
| Molecular Weight | 475.47 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | N-[(1R,3S)-3-(1H-benzimidazol-2-yl)cyclohexyl]-2,3-dihydro-1-benzofuran-5-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(N[C@@H]1CCC[C@H](c2nc3ccccc3[nH]2)C1)c1ccc2c(c1)CCO2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H23N3O2.C2HF3O2/c26-22(16-8-9-20-14(12-16)10-11-27-20)23-17-5-3-4-15(13-17)21-24-18-6-1-2-7-19(18)25-21;3-2(4,5)1(6)7/h1-2,6-9,12,15,17H,3-5,10-11,13H2,(H,23,26)(H,24,25);(H,6,7)/t15-,17+;/m0./s1 |
| InChIKey | SVKDZHHQAQDYRO-KPVRICSOSA-N |
| XLogP | 4.59 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |