C15H16F3N3O2 — CID 68552156
[(3S)-3-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]cyclohexyl]carbamic acid (PubChem CID 68552156) has the molecular formula C15H16F3N3O2 and a molecular weight of 327.31 g/mol. Its IUPAC name is [(3S)-3-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]cyclohexyl]carbamic acid.
| Compound Name | [(3S)-3-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 68552156 |
| Molecular Formula | C15H16F3N3O2 |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | [(3S)-3-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]cyclohexyl]carbamic acid |
| SMILES | O=C(O)NC1CCC[C@H](c2nc3ccc(C(F)(F)F)cc3[nH]2)C1 |
| InChI | InChI=1S/C15H16F3N3O2/c16-15(17,18)9-4-5-11-12(7-9)21-13(20-11)8-2-1-3-10(6-8)19-14(22)23/h4-5,7-8,10,19H,1-3,6H2,(H,20,21)(H,22,23)/t8-,10?/m0/s1 |
| InChIKey | DVIWEUYXISOGLX-PEHGTWAWSA-N |
| XLogP | 3.88 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |