C25H28O8 — CID 68553300
(1E,6E)-1,7-bis[3-methoxy-2-(methoxymethoxy)phenyl]hepta-1,6-diene-3,5-dione (PubChem CID 68553300) has the molecular formula C25H28O8 and a molecular weight of 456.49 g/mol. Its IUPAC name is (1E,6E)-1,7-bis[3-methoxy-2-(methoxymethoxy)phenyl]hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-1,7-bis[3-methoxy-2-(methoxymethoxy)phenyl]hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 68553300 |
| Molecular Formula | C25H28O8 |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | (1E,6E)-1,7-bis[3-methoxy-2-(methoxymethoxy)phenyl]hepta-1,6-diene-3,5-dione |
| SMILES | COCOc1c(/C=C/C(=O)CC(=O)/C=C/c2cccc(OC)c2OCOC)cccc1OC |
| InChI | InChI=1S/C25H28O8/c1-28-16-32-24-18(7-5-9-22(24)30-3)11-13-20(26)15-21(27)14-12-19-8-6-10-23(31-4)25(19)33-17-29-2/h5-14H,15-17H2,1-4H3/b13-11+,14-12+ |
| InChIKey | VPNJHHYZOVHHBA-PHEQNACWSA-N |
| XLogP | 3.92 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|