About [4-(1H-pyrrolo[3,2-b]pyridin-3-yl)cyclohept-3-en-1-yl]carbamic acid
[4-(1H-pyrrolo[3,2-b]pyridin-3-yl)cyclohept-3-en-1-yl]carbamic acid (PubChem CID 68553483) has the molecular formula C15H17N3O2
and a molecular weight of 271.32 g/mol. Its IUPAC name is [4-(1H-pyrrolo[3,2-b]pyridin-3-yl)cyclohept-3-en-1-yl]carbamic acid.
Molecular Properties
| Compound Name | [4-(1H-pyrrolo[3,2-b]pyridin-3-yl)cyclohept-3-en-1-yl]carbamic acid |
| PubChem CID | 68553483 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | [4-(1H-pyrrolo[3,2-b]pyridin-3-yl)cyclohept-3-en-1-yl]carbamic acid |
| SMILES | O=C(O)NC1CC=C(c2c[nH]c3cccnc23)CCC1 |
| InChI | InChI=1S/C15H17N3O2/c19-15(20)18-11-4-1-3-10(6-7-11)12-9-17-13-5-2-8-16-14(12)13/h2,5-6,8-9,11,17-18H,1,3-4,7H2,(H,19,20) |
| InChIKey | KNPZMYJRFYKSAZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [4-(1H-pyrrolo[3,2-b]pyridin-3-yl)cyclohept-3-en-1-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1H-pyrrolo[3,2-b]pyridin-3-yl)cyclohept-3-en-1-yl]carbamic acid?
The IUPAC name of [4-(1H-pyrrolo[3,2-b]pyridin-3-yl)cyclohept-3-en-1-yl]carbamic acid (CID 68553483) is [4-(1H-pyrrolo[3,2-b]pyridin-3-yl)cyclohept-3-en-1-yl]carbamic acid.
What is the SMILES notation for [4-(1H-pyrrolo[3,2-b]pyridin-3-yl)cyclohept-3-en-1-yl]carbamic acid?
The canonical SMILES for [4-(1H-pyrrolo[3,2-b]pyridin-3-yl)cyclohept-3-en-1-yl]carbamic acid is O=C(O)NC1CC=C(c2c[nH]c3cccnc23)CCC1.
What is the InChIKey of [4-(1H-pyrrolo[3,2-b]pyridin-3-yl)cyclohept-3-en-1-yl]carbamic acid?
The InChIKey is KNPZMYJRFYKSAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O2/c19-15(20)18-11-4-1-3-10(6-7-11)12-9-17-13-5-2-8-16-14(12)13/h2,5-6,8-9,11,17-18H,1,3-4,7H2,(H,19,20).
What are the key properties of [4-(1H-pyrrolo[3,2-b]pyridin-3-yl)cyclohept-3-en-1-yl]carbamic acid?
[4-(1H-pyrrolo[3,2-b]pyridin-3-yl)cyclohept-3-en-1-yl]carbamic acid has a molecular weight of 271.32 g/mol, XLogP of 3.16, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1H-pyrrolo[3,2-b]pyridin-3-yl)cyclohept-3-en-1-yl]carbamic acid is sourced from PubChem (CID 68553483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).