C30H29Cl2NO4 — CID 68554001
1-[2-[(2,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]-7-(4-hydroxyphenyl)hepta-1,6-diene-3,5-dione (PubChem CID 68554001) has the molecular formula C30H29Cl2NO4 and a molecular weight of 538.47 g/mol. Its IUPAC name is 1-[2-[(2,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]-7-(4-hydroxyphenyl)hepta-1,6-diene-3,5-dione.
| Compound Name | 1-[2-[(2,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]-7-(4-hydroxyphenyl)hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 68554001 |
| Molecular Formula | C30H29Cl2NO4 |
| Molecular Weight | 538.47 g/mol |
| Exact Mass | 537.15 |
| IUPAC Name | 1-[2-[(2,4-dichlorophenyl)methoxy]-4-(diethylamino)phenyl]-7-(4-hydroxyphenyl)hepta-1,6-diene-3,5-dione |
| SMILES | CCN(CC)c1ccc(C=CC(=O)CC(=O)C=Cc2ccc(O)cc2)c(OCc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C30H29Cl2NO4/c1-3-33(4-2)25-12-9-22(30(18-25)37-20-23-8-11-24(31)17-29(23)32)10-16-28(36)19-27(35)15-7-21-5-13-26(34)14-6-21/h5-18,34H,3-4,19-20H2,1-2H3 |
| InChIKey | JJNSMTBORVTRFC-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.47 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|