About (7-fluoro-3,4-dihydro-2H-1,4-benzoxazin-3-yl)methanol
(7-fluoro-3,4-dihydro-2H-1,4-benzoxazin-3-yl)methanol (PubChem CID 68554157) has the molecular formula C9H10FNO2
and a molecular weight of 183.18 g/mol. Its IUPAC name is (7-fluoro-3,4-dihydro-2H-1,4-benzoxazin-3-yl)methanol.
Analyze (7-fluoro-3,4-dihydro-2H-1,4-benzoxazin-3-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-fluoro-3,4-dihydro-2H-1,4-benzoxazin-3-yl)methanol?
The IUPAC name of (7-fluoro-3,4-dihydro-2H-1,4-benzoxazin-3-yl)methanol (CID 68554157) is (7-fluoro-3,4-dihydro-2H-1,4-benzoxazin-3-yl)methanol.
What is the SMILES notation for (7-fluoro-3,4-dihydro-2H-1,4-benzoxazin-3-yl)methanol?
The canonical SMILES for (7-fluoro-3,4-dihydro-2H-1,4-benzoxazin-3-yl)methanol is OCC1COc2cc(F)ccc2N1.
What is the InChIKey of (7-fluoro-3,4-dihydro-2H-1,4-benzoxazin-3-yl)methanol?
The InChIKey is OZBVEQRBCNXKHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FNO2/c10-6-1-2-8-9(3-6)13-5-7(4-12)11-8/h1-3,7,11-12H,4-5H2.
What are the key properties of (7-fluoro-3,4-dihydro-2H-1,4-benzoxazin-3-yl)methanol?
(7-fluoro-3,4-dihydro-2H-1,4-benzoxazin-3-yl)methanol has a molecular weight of 183.18 g/mol, XLogP of 0.99, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (7-fluoro-3,4-dihydro-2H-1,4-benzoxazin-3-yl)methanol is sourced from PubChem (CID 68554157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).