About N-(6-aminohexyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide
N-(6-aminohexyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide (PubChem CID 68554269) has the molecular formula C11H18N4O3
and a molecular weight of 254.29 g/mol. Its IUPAC name is N-(6-aminohexyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | N-(6-aminohexyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide |
| PubChem CID | 68554269 |
| Molecular Formula | C11H18N4O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | N-(6-aminohexyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide |
| SMILES | NCCCCCCNC(=O)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H18N4O3/c12-5-3-1-2-4-6-13-9(16)8-7-14-11(18)15-10(8)17/h7H,1-6,12H2,(H,13,16)(H2,14,15,17,18) |
| InChIKey | ULODCIUKNASLEM-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 120.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(6-aminohexyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-aminohexyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide?
The IUPAC name of N-(6-aminohexyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide (CID 68554269) is N-(6-aminohexyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide.
What is the SMILES notation for N-(6-aminohexyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide?
The canonical SMILES for N-(6-aminohexyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide is NCCCCCCNC(=O)c1c[nH]c(=O)[nH]c1=O.
What is the InChIKey of N-(6-aminohexyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide?
The InChIKey is ULODCIUKNASLEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4O3/c12-5-3-1-2-4-6-13-9(16)8-7-14-11(18)15-10(8)17/h7H,1-6,12H2,(H,13,16)(H2,14,15,17,18).
What are the key properties of N-(6-aminohexyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide?
N-(6-aminohexyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide has a molecular weight of 254.29 g/mol, XLogP of -0.69, 7 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-aminohexyl)-2,4-dioxo-1H-pyrimidine-5-carboxamide is sourced from PubChem (CID 68554269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).