About 2-fluoro-4-methoxy-N-(1,2-oxazol-3-ylmethyl)aniline
2-fluoro-4-methoxy-N-(1,2-oxazol-3-ylmethyl)aniline (PubChem CID 68554519) has the molecular formula C11H11FN2O2
and a molecular weight of 222.22 g/mol. Its IUPAC name is 2-fluoro-4-methoxy-N-(1,2-oxazol-3-ylmethyl)aniline.
Molecular Properties
| Compound Name | 2-fluoro-4-methoxy-N-(1,2-oxazol-3-ylmethyl)aniline |
| PubChem CID | 68554519 |
| Molecular Formula | C11H11FN2O2 |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 2-fluoro-4-methoxy-N-(1,2-oxazol-3-ylmethyl)aniline |
| SMILES | COc1ccc(NCc2ccon2)c(F)c1 |
| InChI | InChI=1S/C11H11FN2O2/c1-15-9-2-3-11(10(12)6-9)13-7-8-4-5-16-14-8/h2-6,13H,7H2,1H3 |
| InChIKey | GWMPVUGFWCWCOT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-4-methoxy-N-(1,2-oxazol-3-ylmethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-4-methoxy-N-(1,2-oxazol-3-ylmethyl)aniline?
The IUPAC name of 2-fluoro-4-methoxy-N-(1,2-oxazol-3-ylmethyl)aniline (CID 68554519) is 2-fluoro-4-methoxy-N-(1,2-oxazol-3-ylmethyl)aniline.
What is the SMILES notation for 2-fluoro-4-methoxy-N-(1,2-oxazol-3-ylmethyl)aniline?
The canonical SMILES for 2-fluoro-4-methoxy-N-(1,2-oxazol-3-ylmethyl)aniline is COc1ccc(NCc2ccon2)c(F)c1.
What is the InChIKey of 2-fluoro-4-methoxy-N-(1,2-oxazol-3-ylmethyl)aniline?
The InChIKey is GWMPVUGFWCWCOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11FN2O2/c1-15-9-2-3-11(10(12)6-9)13-7-8-4-5-16-14-8/h2-6,13H,7H2,1H3.
What are the key properties of 2-fluoro-4-methoxy-N-(1,2-oxazol-3-ylmethyl)aniline?
2-fluoro-4-methoxy-N-(1,2-oxazol-3-ylmethyl)aniline has a molecular weight of 222.22 g/mol, XLogP of 2.43, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-4-methoxy-N-(1,2-oxazol-3-ylmethyl)aniline is sourced from PubChem (CID 68554519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).