C11H18N6O6 — CID 68554717
2-amino-5-(diaminomethylideneamino)pentanoic acid;2,4-dioxo-1H-pyrimidine-6-carboxylic acid (PubChem CID 68554717) has the molecular formula C11H18N6O6 and a molecular weight of 330.30 g/mol. Its IUPAC name is 2-amino-5-(diaminomethylideneamino)pentanoic acid;2,4-dioxo-1H-pyrimidine-6-carboxylic acid.
| Compound Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;2,4-dioxo-1H-pyrimidine-6-carboxylic acid |
|---|---|
| PubChem CID | 68554717 |
| Molecular Formula | C11H18N6O6 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;2,4-dioxo-1H-pyrimidine-6-carboxylic acid |
| SMILES | NC(N)=NCCCC(N)C(=O)O.O=C(O)c1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C6H14N4O2.C5H4N2O4/c7-4(5(11)12)2-1-3-10-6(8)9;8-3-1-2(4(9)10)6-5(11)7-3/h4H,1-3,7H2,(H,11,12)(H4,8,9,10);1H,(H,9,10)(H2,6,7,8,11) |
| InChIKey | HOIDOMQBCABXLA-UHFFFAOYSA-N |
| XLogP | -2.79 |
| TPSA | 230.74 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | -2.79 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|