C21H33N7O2 — CID 68556245
2-methyl-6-[3-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]butylamino]pyridine-3-carbohydrazide (PubChem CID 68556245) has the molecular formula C21H33N7O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 2-methyl-6-[3-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]butylamino]pyridine-3-carbohydrazide.
| Compound Name | 2-methyl-6-[3-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]butylamino]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 68556245 |
| Molecular Formula | C21H33N7O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.27 |
| IUPAC Name | 2-methyl-6-[3-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]butylamino]pyridine-3-carbohydrazide |
| SMILES | Cc1nc(NCCC(C)C2CCN(c3nc(C(C)C)no3)CC2)ccc1C(=O)NN |
| InChI | InChI=1S/C21H33N7O2/c1-13(2)19-25-21(30-27-19)28-11-8-16(9-12-28)14(3)7-10-23-18-6-5-17(15(4)24-18)20(29)26-22/h5-6,13-14,16H,7-12,22H2,1-4H3,(H,23,24)(H,26,29) |
| InChIKey | KJLYWLBELBDFPL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 122.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|