C29H54O5Si — CID 68556475
diethyl 5-[4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]nonanedioate (PubChem CID 68556475) has the molecular formula C29H54O5Si and a molecular weight of 510.83 g/mol. Its IUPAC name is diethyl 5-[4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]nonanedioate.
| Compound Name | diethyl 5-[4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]nonanedioate |
|---|---|
| PubChem CID | 68556475 |
| Molecular Formula | C29H54O5Si |
| Molecular Weight | 510.83 g/mol |
| Exact Mass | 510.37 |
| IUPAC Name | diethyl 5-[4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]nonanedioate |
| SMILES | CCOC(=O)CCCC(CCCC(=O)OCC)C1CCC2C(O[Si](C)(C)C(C)(C)C)CCCC12C |
| InChI | InChI=1S/C29H54O5Si/c1-9-32-26(30)17-11-14-22(15-12-18-27(31)33-10-2)23-19-20-24-25(16-13-21-29(23,24)6)34-35(7,8)28(3,4)5/h22-25H,9-21H2,1-8H3 |
| InChIKey | RNQXUFRBVGZODX-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.83 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|