C10H13BrN2 — CID 68556930
7-bromo-4-methyl-1,2,3,5-tetrahydro-1,4-benzodiazepine (PubChem CID 68556930) has the molecular formula C10H13BrN2 and a molecular weight of 241.13 g/mol. Its IUPAC name is 7-bromo-4-methyl-1,2,3,5-tetrahydro-1,4-benzodiazepine.
| Compound Name | 7-bromo-4-methyl-1,2,3,5-tetrahydro-1,4-benzodiazepine |
|---|---|
| PubChem CID | 68556930 |
| Molecular Formula | C10H13BrN2 |
| Molecular Weight | 241.13 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | 7-bromo-4-methyl-1,2,3,5-tetrahydro-1,4-benzodiazepine |
| SMILES | CN1CCNc2ccc(Br)cc2C1 |
| InChI | InChI=1S/C10H13BrN2/c1-13-5-4-12-10-3-2-9(11)6-8(10)7-13/h2-3,6,12H,4-5,7H2,1H3 |
| InChIKey | STNXLPFLHUECQI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.13 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |