About methyl 3-phenyl-2-[(6-spiro[indene-1,4'-piperidine]-1'-ylpyridazine-3-carbonyl)amino]propanoate
methyl 3-phenyl-2-[(6-spiro[indene-1,4'-piperidine]-1'-ylpyridazine-3-carbonyl)amino]propanoate (PubChem CID 68557262) has the molecular formula C28H28N4O3
and a molecular weight of 468.56 g/mol. Its IUPAC name is methyl 3-phenyl-2-[(6-spiro[indene-1,4'-piperidine]-1'-ylpyridazine-3-carbonyl)amino]propanoate.
Molecular Properties
| Compound Name | methyl 3-phenyl-2-[(6-spiro[indene-1,4'-piperidine]-1'-ylpyridazine-3-carbonyl)amino]propanoate |
| PubChem CID | 68557262 |
| Molecular Formula | C28H28N4O3 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | methyl 3-phenyl-2-[(6-spiro[indene-1,4'-piperidine]-1'-ylpyridazine-3-carbonyl)amino]propanoate |
| SMILES | COC(=O)C(Cc1ccccc1)NC(=O)c1ccc(N2CCC3(C=Cc4ccccc43)CC2)nn1 |
| InChI | InChI=1S/C28H28N4O3/c1-35-27(34)24(19-20-7-3-2-4-8-20)29-26(33)23-11-12-25(31-30-23)32-17-15-28(16-18-32)14-13-21-9-5-6-10-22(21)28/h2-14,24H,15-19H2,1H3,(H,29,33) |
| InChIKey | FMKNJONSLCTYFM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 3-phenyl-2-[(6-spiro[indene-1,4'-piperidine]-1'-ylpyridazine-3-carbonyl)amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-phenyl-2-[(6-spiro[indene-1,4'-piperidine]-1'-ylpyridazine-3-carbonyl)amino]propanoate?
The IUPAC name of methyl 3-phenyl-2-[(6-spiro[indene-1,4'-piperidine]-1'-ylpyridazine-3-carbonyl)amino]propanoate (CID 68557262) is methyl 3-phenyl-2-[(6-spiro[indene-1,4'-piperidine]-1'-ylpyridazine-3-carbonyl)amino]propanoate.
What is the SMILES notation for methyl 3-phenyl-2-[(6-spiro[indene-1,4'-piperidine]-1'-ylpyridazine-3-carbonyl)amino]propanoate?
The canonical SMILES for methyl 3-phenyl-2-[(6-spiro[indene-1,4'-piperidine]-1'-ylpyridazine-3-carbonyl)amino]propanoate is COC(=O)C(Cc1ccccc1)NC(=O)c1ccc(N2CCC3(C=Cc4ccccc43)CC2)nn1.
What is the InChIKey of methyl 3-phenyl-2-[(6-spiro[indene-1,4'-piperidine]-1'-ylpyridazine-3-carbonyl)amino]propanoate?
The InChIKey is FMKNJONSLCTYFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H28N4O3/c1-35-27(34)24(19-20-7-3-2-4-8-20)29-26(33)23-11-12-25(31-30-23)32-17-15-28(16-18-32)14-13-21-9-5-6-10-22(21)28/h2-14,24H,15-19H2,1H3,(H,29,33).
What are the key properties of methyl 3-phenyl-2-[(6-spiro[indene-1,4'-piperidine]-1'-ylpyridazine-3-carbonyl)amino]propanoate?
methyl 3-phenyl-2-[(6-spiro[indene-1,4'-piperidine]-1'-ylpyridazine-3-carbonyl)amino]propanoate has a molecular weight of 468.56 g/mol, XLogP of 3.56, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-phenyl-2-[(6-spiro[indene-1,4'-piperidine]-1'-ylpyridazine-3-carbonyl)amino]propanoate is sourced from PubChem (CID 68557262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).