About 3,5-bis(1,3,5-triazin-2-yl)benzamide
3,5-bis(1,3,5-triazin-2-yl)benzamide (PubChem CID 68557483) has the molecular formula C13H9N7O
and a molecular weight of 279.26 g/mol. Its IUPAC name is 3,5-bis(1,3,5-triazin-2-yl)benzamide.
Molecular Properties
| Compound Name | 3,5-bis(1,3,5-triazin-2-yl)benzamide |
| PubChem CID | 68557483 |
| Molecular Formula | C13H9N7O |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 3,5-bis(1,3,5-triazin-2-yl)benzamide |
| SMILES | NC(=O)c1cc(-c2ncncn2)cc(-c2ncncn2)c1 |
| InChI | InChI=1S/C13H9N7O/c14-11(21)8-1-9(12-17-4-15-5-18-12)3-10(2-8)13-19-6-16-7-20-13/h1-7H,(H2,14,21) |
| InChIKey | OWYWNKPRMWWEOA-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 120.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3,5-bis(1,3,5-triazin-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-bis(1,3,5-triazin-2-yl)benzamide?
The IUPAC name of 3,5-bis(1,3,5-triazin-2-yl)benzamide (CID 68557483) is 3,5-bis(1,3,5-triazin-2-yl)benzamide.
What is the SMILES notation for 3,5-bis(1,3,5-triazin-2-yl)benzamide?
The canonical SMILES for 3,5-bis(1,3,5-triazin-2-yl)benzamide is NC(=O)c1cc(-c2ncncn2)cc(-c2ncncn2)c1.
What is the InChIKey of 3,5-bis(1,3,5-triazin-2-yl)benzamide?
The InChIKey is OWYWNKPRMWWEOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N7O/c14-11(21)8-1-9(12-17-4-15-5-18-12)3-10(2-8)13-19-6-16-7-20-13/h1-7H,(H2,14,21).
What are the key properties of 3,5-bis(1,3,5-triazin-2-yl)benzamide?
3,5-bis(1,3,5-triazin-2-yl)benzamide has a molecular weight of 279.26 g/mol, XLogP of 0.49, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis(1,3,5-triazin-2-yl)benzamide is sourced from PubChem (CID 68557483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).