About 3-aminothiophene-2,5-dicarboxylic acid
3-aminothiophene-2,5-dicarboxylic acid (PubChem CID 68557502) has the molecular formula C6H5NO4S
and a molecular weight of 187.18 g/mol. Its IUPAC name is 3-aminothiophene-2,5-dicarboxylic acid.
Molecular Properties
| Compound Name | 3-aminothiophene-2,5-dicarboxylic acid |
| PubChem CID | 68557502 |
| Molecular Formula | C6H5NO4S |
| Molecular Weight | 187.18 g/mol |
| Exact Mass | 186.99 |
| IUPAC Name | 3-aminothiophene-2,5-dicarboxylic acid |
| SMILES | Nc1cc(C(=O)O)sc1C(=O)O |
| InChI | InChI=1S/C6H5NO4S/c7-2-1-3(5(8)9)12-4(2)6(10)11/h1H,7H2,(H,8,9)(H,10,11) |
| InChIKey | XTXKHRCGLCASOU-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.18 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-aminothiophene-2,5-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminothiophene-2,5-dicarboxylic acid?
The IUPAC name of 3-aminothiophene-2,5-dicarboxylic acid (CID 68557502) is 3-aminothiophene-2,5-dicarboxylic acid.
What is the SMILES notation for 3-aminothiophene-2,5-dicarboxylic acid?
The canonical SMILES for 3-aminothiophene-2,5-dicarboxylic acid is Nc1cc(C(=O)O)sc1C(=O)O.
What is the InChIKey of 3-aminothiophene-2,5-dicarboxylic acid?
The InChIKey is XTXKHRCGLCASOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO4S/c7-2-1-3(5(8)9)12-4(2)6(10)11/h1H,7H2,(H,8,9)(H,10,11).
What are the key properties of 3-aminothiophene-2,5-dicarboxylic acid?
3-aminothiophene-2,5-dicarboxylic acid has a molecular weight of 187.18 g/mol, XLogP of 0.73, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminothiophene-2,5-dicarboxylic acid is sourced from PubChem (CID 68557502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).