About 2-(3,4-difluorophenyl)-2H-imidazole
2-(3,4-difluorophenyl)-2H-imidazole (PubChem CID 68557525) has the molecular formula C9H6F2N2
and a molecular weight of 180.16 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-2H-imidazole.
Molecular Properties
| Compound Name | 2-(3,4-difluorophenyl)-2H-imidazole |
| PubChem CID | 68557525 |
| Molecular Formula | C9H6F2N2 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 2-(3,4-difluorophenyl)-2H-imidazole |
| SMILES | Fc1ccc(C2N=CC=N2)cc1F |
| InChI | InChI=1S/C9H6F2N2/c10-7-2-1-6(5-8(7)11)9-12-3-4-13-9/h1-5,9H |
| InChIKey | ZUWJBYANVJGRGL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3,4-difluorophenyl)-2H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-difluorophenyl)-2H-imidazole?
The IUPAC name of 2-(3,4-difluorophenyl)-2H-imidazole (CID 68557525) is 2-(3,4-difluorophenyl)-2H-imidazole.
What is the SMILES notation for 2-(3,4-difluorophenyl)-2H-imidazole?
The canonical SMILES for 2-(3,4-difluorophenyl)-2H-imidazole is Fc1ccc(C2N=CC=N2)cc1F.
What is the InChIKey of 2-(3,4-difluorophenyl)-2H-imidazole?
The InChIKey is ZUWJBYANVJGRGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6F2N2/c10-7-2-1-6(5-8(7)11)9-12-3-4-13-9/h1-5,9H.
What are the key properties of 2-(3,4-difluorophenyl)-2H-imidazole?
2-(3,4-difluorophenyl)-2H-imidazole has a molecular weight of 180.16 g/mol, XLogP of 2.12, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-difluorophenyl)-2H-imidazole is sourced from PubChem (CID 68557525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).