C11H14N2S — CID 68557678
4-cyclopropyl-7-methyl-2,3-dihydro-1,2,4-benzothiadiazine (PubChem CID 68557678) has the molecular formula C11H14N2S and a molecular weight of 206.31 g/mol. Its IUPAC name is 4-cyclopropyl-7-methyl-2,3-dihydro-1,2,4-benzothiadiazine.
| Compound Name | 4-cyclopropyl-7-methyl-2,3-dihydro-1,2,4-benzothiadiazine |
|---|---|
| PubChem CID | 68557678 |
| Molecular Formula | C11H14N2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 4-cyclopropyl-7-methyl-2,3-dihydro-1,2,4-benzothiadiazine |
| SMILES | Cc1ccc2c(c1)SNCN2C1CC1 |
| InChI | InChI=1S/C11H14N2S/c1-8-2-5-10-11(6-8)14-12-7-13(10)9-3-4-9/h2,5-6,9,12H,3-4,7H2,1H3 |
| InChIKey | UFIXEOHYLXCXMT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|