About 4-[3,3,3-trifluoro-1-(4-hydroxyphenyl)sulfanylpropyl]phenol
4-[3,3,3-trifluoro-1-(4-hydroxyphenyl)sulfanylpropyl]phenol (PubChem CID 68557982) has the molecular formula C15H13F3O2S
and a molecular weight of 314.33 g/mol. Its IUPAC name is 4-[3,3,3-trifluoro-1-(4-hydroxyphenyl)sulfanylpropyl]phenol.
Molecular Properties
| Compound Name | 4-[3,3,3-trifluoro-1-(4-hydroxyphenyl)sulfanylpropyl]phenol |
| PubChem CID | 68557982 |
| Molecular Formula | C15H13F3O2S |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 4-[3,3,3-trifluoro-1-(4-hydroxyphenyl)sulfanylpropyl]phenol |
| SMILES | Oc1ccc(SC(CC(F)(F)F)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C15H13F3O2S/c16-15(17,18)9-14(10-1-3-11(19)4-2-10)21-13-7-5-12(20)6-8-13/h1-8,14,19-20H,9H2 |
| InChIKey | NLIAJVSYOKLZKG-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[3,3,3-trifluoro-1-(4-hydroxyphenyl)sulfanylpropyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3,3,3-trifluoro-1-(4-hydroxyphenyl)sulfanylpropyl]phenol?
The IUPAC name of 4-[3,3,3-trifluoro-1-(4-hydroxyphenyl)sulfanylpropyl]phenol (CID 68557982) is 4-[3,3,3-trifluoro-1-(4-hydroxyphenyl)sulfanylpropyl]phenol.
What is the SMILES notation for 4-[3,3,3-trifluoro-1-(4-hydroxyphenyl)sulfanylpropyl]phenol?
The canonical SMILES for 4-[3,3,3-trifluoro-1-(4-hydroxyphenyl)sulfanylpropyl]phenol is Oc1ccc(SC(CC(F)(F)F)c2ccc(O)cc2)cc1.
What is the InChIKey of 4-[3,3,3-trifluoro-1-(4-hydroxyphenyl)sulfanylpropyl]phenol?
The InChIKey is NLIAJVSYOKLZKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13F3O2S/c16-15(17,18)9-14(10-1-3-11(19)4-2-10)21-13-7-5-12(20)6-8-13/h1-8,14,19-20H,9H2.
What are the key properties of 4-[3,3,3-trifluoro-1-(4-hydroxyphenyl)sulfanylpropyl]phenol?
4-[3,3,3-trifluoro-1-(4-hydroxyphenyl)sulfanylpropyl]phenol has a molecular weight of 314.33 g/mol, XLogP of 4.88, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3,3,3-trifluoro-1-(4-hydroxyphenyl)sulfanylpropyl]phenol is sourced from PubChem (CID 68557982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).