C25H26O5S — CID 68558572
3-[4-[[5-(4-acetylphenyl)-3-methylthiophen-2-yl]methoxy]phenyl]-2-ethoxypropanoic acid (PubChem CID 68558572) has the molecular formula C25H26O5S and a molecular weight of 438.55 g/mol. Its IUPAC name is 3-[4-[[5-(4-acetylphenyl)-3-methylthiophen-2-yl]methoxy]phenyl]-2-ethoxypropanoic acid.
| Compound Name | 3-[4-[[5-(4-acetylphenyl)-3-methylthiophen-2-yl]methoxy]phenyl]-2-ethoxypropanoic acid |
|---|---|
| PubChem CID | 68558572 |
| Molecular Formula | C25H26O5S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 3-[4-[[5-(4-acetylphenyl)-3-methylthiophen-2-yl]methoxy]phenyl]-2-ethoxypropanoic acid |
| SMILES | CCOC(Cc1ccc(OCc2sc(-c3ccc(C(C)=O)cc3)cc2C)cc1)C(=O)O |
| InChI | InChI=1S/C25H26O5S/c1-4-29-22(25(27)28)14-18-5-11-21(12-6-18)30-15-24-16(2)13-23(31-24)20-9-7-19(8-10-20)17(3)26/h5-13,22H,4,14-15H2,1-3H3,(H,27,28) |
| InChIKey | FEGJNBUOIUMERQ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |