C14H18N2O2 — CID 68558737
(1S,5S)-6-(4-methoxyphenyl)-3,6-diazabicyclo[3.2.2]nonan-2-one (PubChem CID 68558737) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is (1S,5S)-6-(4-methoxyphenyl)-3,6-diazabicyclo[3.2.2]nonan-2-one.
| Compound Name | (1S,5S)-6-(4-methoxyphenyl)-3,6-diazabicyclo[3.2.2]nonan-2-one |
|---|---|
| PubChem CID | 68558737 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | (1S,5S)-6-(4-methoxyphenyl)-3,6-diazabicyclo[3.2.2]nonan-2-one |
| SMILES | COc1ccc(N2C[C@@H]3CC[C@H]2CNC3=O)cc1 |
| InChI | InChI=1S/C14H18N2O2/c1-18-13-6-4-11(5-7-13)16-9-10-2-3-12(16)8-15-14(10)17/h4-7,10,12H,2-3,8-9H2,1H3,(H,15,17)/t10-,12-/m0/s1 |
| InChIKey | CDEQCKBBZAMUFB-JQWIXIFHSA-N |
| XLogP | 1.41 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|