C18H26FN3O2 — CID 68559084
9-(2-fluorophenoxy)-3-methyl-5-(1,2,4-triazol-1-yl)nonan-4-ol (PubChem CID 68559084) has the molecular formula C18H26FN3O2 and a molecular weight of 335.42 g/mol. Its IUPAC name is 9-(2-fluorophenoxy)-3-methyl-5-(1,2,4-triazol-1-yl)nonan-4-ol.
| Compound Name | 9-(2-fluorophenoxy)-3-methyl-5-(1,2,4-triazol-1-yl)nonan-4-ol |
|---|---|
| PubChem CID | 68559084 |
| Molecular Formula | C18H26FN3O2 |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 9-(2-fluorophenoxy)-3-methyl-5-(1,2,4-triazol-1-yl)nonan-4-ol |
| SMILES | CCC(C)C(O)C(CCCCOc1ccccc1F)n1cncn1 |
| InChI | InChI=1S/C18H26FN3O2/c1-3-14(2)18(23)16(22-13-20-12-21-22)9-6-7-11-24-17-10-5-4-8-15(17)19/h4-5,8,10,12-14,16,18,23H,3,6-7,9,11H2,1-2H3 |
| InChIKey | OSRDYXYMQJVLNN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|