C28H27F2N3O3 — CID 68559094
[6-[(3,5-difluoro-4-methoxyphenyl)methyl]-1,2,4,7-tetrahydroindolo[2,3-c][1,7]naphthyridin-3-yl]-[(1R,2S)-2-hydroxycyclopentyl]methanone (PubChem CID 68559094) has the molecular formula C28H27F2N3O3 and a molecular weight of 491.54 g/mol. Its IUPAC name is [6-[(3,5-difluoro-4-methoxyphenyl)methyl]-1,2,4,7-tetrahydroindolo[2,3-c][1,7]naphthyridin-3-yl]-[(1R,2S)-2-hydroxycyclopentyl]methanone.
| Compound Name | [6-[(3,5-difluoro-4-methoxyphenyl)methyl]-1,2,4,7-tetrahydroindolo[2,3-c][1,7]naphthyridin-3-yl]-[(1R,2S)-2-hydroxycyclopentyl]methanone |
|---|---|
| PubChem CID | 68559094 |
| Molecular Formula | C28H27F2N3O3 |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | [6-[(3,5-difluoro-4-methoxyphenyl)methyl]-1,2,4,7-tetrahydroindolo[2,3-c][1,7]naphthyridin-3-yl]-[(1R,2S)-2-hydroxycyclopentyl]methanone |
| SMILES | COc1c(F)cc(Cc2nc3c(c4c2[nH]c2ccccc24)CCN(C(=O)[C@@H]2CCC[C@@H]2O)C3)cc1F |
| InChI | InChI=1S/C28H27F2N3O3/c1-36-27-19(29)11-15(12-20(27)30)13-22-26-25(16-5-2-3-7-21(16)32-26)17-9-10-33(14-23(17)31-22)28(35)18-6-4-8-24(18)34/h2-3,5,7,11-12,18,24,32,34H,4,6,8-10,13-14H2,1H3/t18-,24+/m1/s1 |
| InChIKey | JAOXUPQAMNGVRF-KOSHJBKYSA-N |
| XLogP | 4.64 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |