About 3-[2-[(3,4-dichlorophenyl)methylsulfinyl]ethenyl]thiophene
3-[2-[(3,4-dichlorophenyl)methylsulfinyl]ethenyl]thiophene (PubChem CID 68559378) has the molecular formula C13H10Cl2OS2
and a molecular weight of 317.26 g/mol. Its IUPAC name is 3-[2-[(3,4-dichlorophenyl)methylsulfinyl]ethenyl]thiophene.
Molecular Properties
| Compound Name | 3-[2-[(3,4-dichlorophenyl)methylsulfinyl]ethenyl]thiophene |
| PubChem CID | 68559378 |
| Molecular Formula | C13H10Cl2OS2 |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 315.96 |
| IUPAC Name | 3-[2-[(3,4-dichlorophenyl)methylsulfinyl]ethenyl]thiophene |
| SMILES | O=S(C=Cc1ccsc1)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H10Cl2OS2/c14-12-2-1-11(7-13(12)15)9-18(16)6-4-10-3-5-17-8-10/h1-8H,9H2 |
| InChIKey | YZGFUJCZZSUBOU-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[2-[(3,4-dichlorophenyl)methylsulfinyl]ethenyl]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[(3,4-dichlorophenyl)methylsulfinyl]ethenyl]thiophene?
The IUPAC name of 3-[2-[(3,4-dichlorophenyl)methylsulfinyl]ethenyl]thiophene (CID 68559378) is 3-[2-[(3,4-dichlorophenyl)methylsulfinyl]ethenyl]thiophene.
What is the SMILES notation for 3-[2-[(3,4-dichlorophenyl)methylsulfinyl]ethenyl]thiophene?
The canonical SMILES for 3-[2-[(3,4-dichlorophenyl)methylsulfinyl]ethenyl]thiophene is O=S(C=Cc1ccsc1)Cc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 3-[2-[(3,4-dichlorophenyl)methylsulfinyl]ethenyl]thiophene?
The InChIKey is YZGFUJCZZSUBOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10Cl2OS2/c14-12-2-1-11(7-13(12)15)9-18(16)6-4-10-3-5-17-8-10/h1-8H,9H2.
What are the key properties of 3-[2-[(3,4-dichlorophenyl)methylsulfinyl]ethenyl]thiophene?
3-[2-[(3,4-dichlorophenyl)methylsulfinyl]ethenyl]thiophene has a molecular weight of 317.26 g/mol, XLogP of 4.97, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[(3,4-dichlorophenyl)methylsulfinyl]ethenyl]thiophene is sourced from PubChem (CID 68559378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).