C17H21ClFN3O2 — CID 68559422
1-(1-chlorocyclopropyl)-6-(2-fluorophenoxy)-2-(1,2,4-triazol-1-yl)hexan-1-ol (PubChem CID 68559422) has the molecular formula C17H21ClFN3O2 and a molecular weight of 353.83 g/mol. Its IUPAC name is 1-(1-chlorocyclopropyl)-6-(2-fluorophenoxy)-2-(1,2,4-triazol-1-yl)hexan-1-ol.
| Compound Name | 1-(1-chlorocyclopropyl)-6-(2-fluorophenoxy)-2-(1,2,4-triazol-1-yl)hexan-1-ol |
|---|---|
| PubChem CID | 68559422 |
| Molecular Formula | C17H21ClFN3O2 |
| Molecular Weight | 353.83 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 1-(1-chlorocyclopropyl)-6-(2-fluorophenoxy)-2-(1,2,4-triazol-1-yl)hexan-1-ol |
| SMILES | OC(C(CCCCOc1ccccc1F)n1cncn1)C1(Cl)CC1 |
| InChI | InChI=1S/C17H21ClFN3O2/c18-17(8-9-17)16(23)14(22-12-20-11-21-22)6-3-4-10-24-15-7-2-1-5-13(15)19/h1-2,5,7,11-12,14,16,23H,3-4,6,8-10H2 |
| InChIKey | NSNAVFTVWCWGIW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.83 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|