About N'-(2-amino-4,5-difluorophenyl)-N'-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]heptanediamide
N'-(2-amino-4,5-difluorophenyl)-N'-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]heptanediamide (PubChem CID 68559631) has the molecular formula C23H24F2N4O3S
and a molecular weight of 474.53 g/mol. Its IUPAC name is N'-(2-amino-4,5-difluorophenyl)-N'-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]heptanediamide.
Molecular Properties
| Compound Name | N'-(2-amino-4,5-difluorophenyl)-N'-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]heptanediamide |
| PubChem CID | 68559631 |
| Molecular Formula | C23H24F2N4O3S |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | N'-(2-amino-4,5-difluorophenyl)-N'-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]heptanediamide |
| SMILES | COc1ccc(-c2csc(N(C(=O)CCCCCC(N)=O)c3cc(F)c(F)cc3N)n2)cc1 |
| InChI | InChI=1S/C23H24F2N4O3S/c1-32-15-9-7-14(8-10-15)19-13-33-23(28-19)29(20-12-17(25)16(24)11-18(20)26)22(31)6-4-2-3-5-21(27)30/h7-13H,2-6,26H2,1H3,(H2,27,30) |
| InChIKey | HTJMPOKPBIZMKP-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 111.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-amino-4,5-difluorophenyl)-N'-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]heptanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-amino-4,5-difluorophenyl)-N'-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]heptanediamide?
The IUPAC name of N'-(2-amino-4,5-difluorophenyl)-N'-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]heptanediamide (CID 68559631) is N'-(2-amino-4,5-difluorophenyl)-N'-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]heptanediamide.
What is the SMILES notation for N'-(2-amino-4,5-difluorophenyl)-N'-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]heptanediamide?
The canonical SMILES for N'-(2-amino-4,5-difluorophenyl)-N'-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]heptanediamide is COc1ccc(-c2csc(N(C(=O)CCCCCC(N)=O)c3cc(F)c(F)cc3N)n2)cc1.
What is the InChIKey of N'-(2-amino-4,5-difluorophenyl)-N'-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]heptanediamide?
The InChIKey is HTJMPOKPBIZMKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24F2N4O3S/c1-32-15-9-7-14(8-10-15)19-13-33-23(28-19)29(20-12-17(25)16(24)11-18(20)26)22(31)6-4-2-3-5-21(27)30/h7-13H,2-6,26H2,1H3,(H2,27,30).
What are the key properties of N'-(2-amino-4,5-difluorophenyl)-N'-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]heptanediamide?
N'-(2-amino-4,5-difluorophenyl)-N'-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]heptanediamide has a molecular weight of 474.53 g/mol, XLogP of 4.78, 10 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-amino-4,5-difluorophenyl)-N'-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]heptanediamide is sourced from PubChem (CID 68559631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).