C32H41BN2O5S — CID 68559919
ethyl 1-[4-[5-methyl-2-[[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]phenyl]-1,3-thiazol-2-yl]piperidine-4-carboxylate (PubChem CID 68559919) has the molecular formula C32H41BN2O5S and a molecular weight of 576.57 g/mol. Its IUPAC name is ethyl 1-[4-[5-methyl-2-[[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]phenyl]-1,3-thiazol-2-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[4-[5-methyl-2-[[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]phenyl]-1,3-thiazol-2-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 68559919 |
| Molecular Formula | C32H41BN2O5S |
| Molecular Weight | 576.57 g/mol |
| Exact Mass | 576.28 |
| IUPAC Name | ethyl 1-[4-[5-methyl-2-[[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methoxy]phenyl]-1,3-thiazol-2-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2nc(-c3cc(C)ccc3OCc3ccc(B4OC(C)(C)C(C)(C)O4)cc3C)cs2)CC1 |
| InChI | InChI=1S/C32H41BN2O5S/c1-8-37-29(36)23-13-15-35(16-14-23)30-34-27(20-41-30)26-17-21(2)9-12-28(26)38-19-24-10-11-25(18-22(24)3)33-39-31(4,5)32(6,7)40-33/h9-12,17-18,20,23H,8,13-16,19H2,1-7H3 |
| InChIKey | OPWXTFILHWNCLF-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 70.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.57 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|